C27H31N — CID 67951358
3-[4-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a-tetrahydronaphthalen-1-yl)cyclohexen-1-yl]-1,2-dihydropyridine (PubChem CID 67951358) has the molecular formula C27H31N and a molecular weight of 369.55 g/mol. Its IUPAC name is 3-[4-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a-tetrahydronaphthalen-1-yl)cyclohexen-1-yl]-1,2-dihydropyridine.
| Compound Name | 3-[4-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a-tetrahydronaphthalen-1-yl)cyclohexen-1-yl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 67951358 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 3-[4-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a-tetrahydronaphthalen-1-yl)cyclohexen-1-yl]-1,2-dihydropyridine |
| SMILES | C1=CNCC(C2=CCC(C3=C4C=CC=CC4C(C4=CCCC=C4)CC3)CC2)=C1 |
| InChI | InChI=1S/C27H31N/c1-2-7-21(8-3-1)24-16-17-25(27-11-5-4-10-26(24)27)22-14-12-20(13-15-22)23-9-6-18-28-19-23/h2,4-12,18,22,24,26,28H,1,3,13-17,19H2 |
| InChIKey | KLCQGPYGVMULML-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |