C38H51N — CID 67951367
2-[4-[4-(2-methylidenecyclohex-3-en-1-yl)-4-[4-(1,2,5,6-tetrahydronaphthalen-2-yl)cyclohex-2-en-1-yl]butyl]cyclohexa-1,5-dien-1-yl]pent-4-en-1-amine (PubChem CID 67951367) has the molecular formula C38H51N and a molecular weight of 521.83 g/mol. Its IUPAC name is 2-[4-[4-(2-methylidenecyclohex-3-en-1-yl)-4-[4-(1,2,5,6-tetrahydronaphthalen-2-yl)cyclohex-2-en-1-yl]butyl]cyclohexa-1,5-dien-1-yl]pent-4-en-1-amine.
| Compound Name | 2-[4-[4-(2-methylidenecyclohex-3-en-1-yl)-4-[4-(1,2,5,6-tetrahydronaphthalen-2-yl)cyclohex-2-en-1-yl]butyl]cyclohexa-1,5-dien-1-yl]pent-4-en-1-amine |
|---|---|
| PubChem CID | 67951367 |
| Molecular Formula | C38H51N |
| Molecular Weight | 521.83 g/mol |
| Exact Mass | 521.40 |
| IUPAC Name | 2-[4-[4-(2-methylidenecyclohex-3-en-1-yl)-4-[4-(1,2,5,6-tetrahydronaphthalen-2-yl)cyclohex-2-en-1-yl]butyl]cyclohexa-1,5-dien-1-yl]pent-4-en-1-amine |
| SMILES | C=CCC(CN)C1=CCC(CCCC(C2C=CC(C3C=CC4=C(C=CCC4)C3)CC2)C2CCC=CC2=C)C=C1 |
| InChI | InChI=1S/C38H51N/c1-3-9-36(27-39)32-18-16-29(17-19-32)11-8-15-38(37-14-7-4-10-28(37)2)33-23-20-31(21-24-33)35-25-22-30-12-5-6-13-34(30)26-35/h3-4,6,10,13,16,18-20,22-23,25,29,31,33,35-38H,1-2,5,7-9,11-12,14-15,17,21,24,26-27,39H2 |
| InChIKey | BHHVTQDHZAXQBN-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.83 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|