C43H64N2 — CID 67951374
(2S)-N-[6-[4-[4-(3,4-dihydro-2H-pyrrol-4-yl)cyclohex-2-en-1-yl]-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]-3-heptan-3-ylcyclohexen-1-yl]-1,2,3,4,5,6,7,8-octahydronaphthalen-2-amine (PubChem CID 67951374) has the molecular formula C43H64N2 and a molecular weight of 609.00 g/mol. Its IUPAC name is (2S)-N-[6-[4-[4-(3,4-dihydro-2H-pyrrol-4-yl)cyclohex-2-en-1-yl]-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]-3-heptan-3-ylcyclohexen-1-yl]-1,2,3,4,5,6,7,8-octahydronaphthalen-2-amine.
| Compound Name | (2S)-N-[6-[4-[4-(3,4-dihydro-2H-pyrrol-4-yl)cyclohex-2-en-1-yl]-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]-3-heptan-3-ylcyclohexen-1-yl]-1,2,3,4,5,6,7,8-octahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 67951374 |
| Molecular Formula | C43H64N2 |
| Molecular Weight | 609.00 g/mol |
| Exact Mass | 608.51 |
| IUPAC Name | (2S)-N-[6-[4-[4-(3,4-dihydro-2H-pyrrol-4-yl)cyclohex-2-en-1-yl]-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]-3-heptan-3-ylcyclohexen-1-yl]-1,2,3,4,5,6,7,8-octahydronaphthalen-2-amine |
| SMILES | CCCCC(CC)C1C=C(N[C@H]2CCC3=C(CCCC3)C2)C(C2C=CC(C3C=CC(C4C=NCC4)CC3)C3C=CCCC23)CC1 |
| InChI | InChI=1S/C43H64N2/c1-3-5-10-30(4-2)35-20-22-42(43(28-35)45-37-21-19-31-11-6-7-12-34(31)27-37)41-24-23-38(39-13-8-9-14-40(39)41)33-17-15-32(16-18-33)36-25-26-44-29-36/h8,13,15,17,23-24,28-30,32-33,35-42,45H,3-7,9-12,14,16,18-22,25-27H2,1-2H3/t30?,32?,33?,35?,36?,37-,38?,39?,40?,41?,42?/m0/s1 |
| InChIKey | KRAWNECNTIGFKP-HNPQPBGVSA-N |
| XLogP | 11.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.00 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|