C45H69N3 — CID 67951435
(9E)-9-(aminomethylidene)-10-[3-[4-[5-(cyclohexen-1-yl)cyclohex-2-en-1-yl]-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]butyl]-11-N-phenyldodecane-1,11-diamine (PubChem CID 67951435) has the molecular formula C45H69N3 and a molecular weight of 652.07 g/mol. Its IUPAC name is (9E)-9-(aminomethylidene)-10-[3-[4-[5-(cyclohexen-1-yl)cyclohex-2-en-1-yl]-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]butyl]-11-N-phenyldodecane-1,11-diamine.
| Compound Name | (9E)-9-(aminomethylidene)-10-[3-[4-[5-(cyclohexen-1-yl)cyclohex-2-en-1-yl]-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]butyl]-11-N-phenyldodecane-1,11-diamine |
|---|---|
| PubChem CID | 67951435 |
| Molecular Formula | C45H69N3 |
| Molecular Weight | 652.07 g/mol |
| Exact Mass | 651.55 |
| IUPAC Name | (9E)-9-(aminomethylidene)-10-[3-[4-[5-(cyclohexen-1-yl)cyclohex-2-en-1-yl]-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]butyl]-11-N-phenyldodecane-1,11-diamine |
| SMILES | CC(CCC(/C(=C/N)CCCCCCCCN)C(C)Nc1ccccc1)C1C=CC(C2C=CCC(C3=CCCCC3)C2)C2C=CCCC12 |
| InChI | InChI=1S/C45H69N3/c1-34(27-28-42(35(2)48-40-23-12-8-13-24-40)39(33-47)20-9-5-3-4-6-16-31-46)41-29-30-43(45-26-15-14-25-44(41)45)38-22-17-21-37(32-38)36-18-10-7-11-19-36/h8,12-13,15,17-18,22-24,26,29-30,33-35,37-38,41-45,48H,3-7,9-11,14,16,19-21,25,27-28,31-32,46-47H2,1-2H3/b39-33+ |
| InChIKey | KYHSGZWSQOUTMX-YQOUJOJOSA-N |
| XLogP | 11.52 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.07 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|