C34H51N — CID 67951438
(Z)-7-[4-(4-cyclohex-2-en-1-yl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl)cyclohexa-2,4-dien-1-yl]-2-ethenyl-7-methylnon-5-en-1-amine (PubChem CID 67951438) has the molecular formula C34H51N and a molecular weight of 473.79 g/mol. Its IUPAC name is (Z)-7-[4-(4-cyclohex-2-en-1-yl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl)cyclohexa-2,4-dien-1-yl]-2-ethenyl-7-methylnon-5-en-1-amine.
| Compound Name | (Z)-7-[4-(4-cyclohex-2-en-1-yl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl)cyclohexa-2,4-dien-1-yl]-2-ethenyl-7-methylnon-5-en-1-amine |
|---|---|
| PubChem CID | 67951438 |
| Molecular Formula | C34H51N |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.40 |
| IUPAC Name | (Z)-7-[4-(4-cyclohex-2-en-1-yl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl)cyclohexa-2,4-dien-1-yl]-2-ethenyl-7-methylnon-5-en-1-amine |
| SMILES | C=CC(CN)CC/C=C\C(C)(CC)C1C=CC(C2CCC(C3C=CCCC3)=C3CCCCC32)=CC1 |
| InChI | InChI=1S/C34H51N/c1-4-26(25-35)13-11-12-24-34(3,5-2)29-20-18-28(19-21-29)31-23-22-30(27-14-7-6-8-15-27)32-16-9-10-17-33(31)32/h4,7,12,14,18-20,24,26-27,29,31,33H,1,5-6,8-11,13,15-17,21-23,25,35H2,2-3H3/b24-12- |
| InChIKey | LUYCCGDUVPZOTD-MSXFZWOLSA-N |
| XLogP | 9.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|