C38H53N — CID 67951443
2-[4-[4-[4-[(1S)-2-(cyclohexen-1-yl)cyclohex-3-en-1-yl]cyclohex-3-en-1-yl]-1,2,3,8a-tetrahydronaphthalen-1-yl]cyclohex-3-en-1-yl]butan-1-amine (PubChem CID 67951443) has the molecular formula C38H53N and a molecular weight of 523.85 g/mol. Its IUPAC name is 2-[4-[4-[4-[(1S)-2-(cyclohexen-1-yl)cyclohex-3-en-1-yl]cyclohex-3-en-1-yl]-1,2,3,8a-tetrahydronaphthalen-1-yl]cyclohex-3-en-1-yl]butan-1-amine.
| Compound Name | 2-[4-[4-[4-[(1S)-2-(cyclohexen-1-yl)cyclohex-3-en-1-yl]cyclohex-3-en-1-yl]-1,2,3,8a-tetrahydronaphthalen-1-yl]cyclohex-3-en-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 67951443 |
| Molecular Formula | C38H53N |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.42 |
| IUPAC Name | 2-[4-[4-[4-[(1S)-2-(cyclohexen-1-yl)cyclohex-3-en-1-yl]cyclohex-3-en-1-yl]-1,2,3,8a-tetrahydronaphthalen-1-yl]cyclohex-3-en-1-yl]butan-1-amine |
| SMILES | CCC(CN)C1CC=C(C2CCC(C3CC=C([C@H]4CCC=CC4C4=CCCCC4)CC3)=C3C=CC=CC32)CC1 |
| InChI | InChI=1S/C38H53N/c1-2-27(26-39)28-16-18-31(19-17-28)35-24-25-36(38-15-9-8-14-37(35)38)32-22-20-30(21-23-32)34-13-7-6-12-33(34)29-10-4-3-5-11-29/h6,8-10,12,14-15,18,20,27-28,32-35,37H,2-5,7,11,13,16-17,19,21-26,39H2,1H3/t27?,28?,32?,33?,34-,35?,37?/m1/s1 |
| InChIKey | WINMJDIYVHJEND-KAHIHZPNSA-N |
| XLogP | 9.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|