C46H69N — CID 67951445
10-cyclohex-2-en-1-yl-12-(3,4,5,6,7,8-hexahydronaphthalen-2-yl)-5-methyl-8-[5-[(Z)-oct-5-en-4-yl]cyclohex-2-en-1-yl]-2,3,4,4a,5,7,8,9,9a,11,12,12a-dodecahydro-1H-benzo[d][1]benzazocine (PubChem CID 67951445) has the molecular formula C46H69N and a molecular weight of 636.07 g/mol. Its IUPAC name is 10-cyclohex-2-en-1-yl-12-(3,4,5,6,7,8-hexahydronaphthalen-2-yl)-5-methyl-8-[5-[(Z)-oct-5-en-4-yl]cyclohex-2-en-1-yl]-2,3,4,4a,5,7,8,9,9a,11,12,12a-dodecahydro-1H-benzo[d][1]benzazocine.
| Compound Name | 10-cyclohex-2-en-1-yl-12-(3,4,5,6,7,8-hexahydronaphthalen-2-yl)-5-methyl-8-[5-[(Z)-oct-5-en-4-yl]cyclohex-2-en-1-yl]-2,3,4,4a,5,7,8,9,9a,11,12,12a-dodecahydro-1H-benzo[d][1]benzazocine |
|---|---|
| PubChem CID | 67951445 |
| Molecular Formula | C46H69N |
| Molecular Weight | 636.07 g/mol |
| Exact Mass | 635.54 |
| IUPAC Name | 10-cyclohex-2-en-1-yl-12-(3,4,5,6,7,8-hexahydronaphthalen-2-yl)-5-methyl-8-[5-[(Z)-oct-5-en-4-yl]cyclohex-2-en-1-yl]-2,3,4,4a,5,7,8,9,9a,11,12,12a-dodecahydro-1H-benzo[d][1]benzazocine |
| SMILES | CC/C=C\C(CCC)C1CC=CC(C2CC=C3C(C)C4CCCCC4C(C4=CC5=C(CCCC5)CC4)CN(C4C=CCCC4)C3C2)C1 |
| InChI | InChI=1S/C46H69N/c1-4-6-16-34(15-5-2)37-19-14-20-38(29-37)39-27-28-43-33(3)42-23-12-13-24-44(42)45(40-26-25-35-17-10-11-18-36(35)30-40)32-47(46(43)31-39)41-21-8-7-9-22-41/h6,8,14,16,20-21,28,30,33-34,37-39,41-42,44-46H,4-5,7,9-13,15,17-19,22-27,29,31-32H2,1-3H3/b16-6- |
| InChIKey | HSEDUOSTDJIRPM-SOFYXZRVSA-N |
| XLogP | 12.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.07 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|