C37H41N — CID 67951446
3-[4-[4-[4-(5-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)cyclohex-3-en-1-yl]-1,2,3,8a-tetrahydronaphthalen-1-yl]phenyl]-1,2-dihydroazete (PubChem CID 67951446) has the molecular formula C37H41N and a molecular weight of 499.74 g/mol. Its IUPAC name is 3-[4-[4-[4-(5-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)cyclohex-3-en-1-yl]-1,2,3,8a-tetrahydronaphthalen-1-yl]phenyl]-1,2-dihydroazete.
| Compound Name | 3-[4-[4-[4-(5-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)cyclohex-3-en-1-yl]-1,2,3,8a-tetrahydronaphthalen-1-yl]phenyl]-1,2-dihydroazete |
|---|---|
| PubChem CID | 67951446 |
| Molecular Formula | C37H41N |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | 3-[4-[4-[4-(5-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)cyclohex-3-en-1-yl]-1,2,3,8a-tetrahydronaphthalen-1-yl]phenyl]-1,2-dihydroazete |
| SMILES | C1=CC2=C(C3CC=C(C4=CC=CC(C5C=CCCC5)C4)CC3)CCC(c3ccc(C4=CNC4)cc3)C2C=C1 |
| InChI | InChI=1S/C37H41N/c1-2-7-26(8-3-1)31-9-6-10-32(23-31)27-13-17-29(18-14-27)34-21-22-35(37-12-5-4-11-36(34)37)30-19-15-28(16-20-30)33-24-38-25-33/h2,4-7,9-13,15-16,19-20,24,26,29,31,35,37-38H,1,3,8,14,17-18,21-23,25H2 |
| InChIKey | XOEQHCKOLKNSKJ-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|