C43H65N — CID 67951448
N-[2-[(2E)-2-[1-[4-[4-[(1S)-cyclohex-3-en-1-yl]cyclohexyl]cyclohex-3-en-1-yl]ethylidene]cyclohex-3-en-1-yl]-3-ethylpentyl]-1,2,4a,5,6,8a-hexahydronaphthalen-2-amine (PubChem CID 67951448) has the molecular formula C43H65N and a molecular weight of 596.00 g/mol. Its IUPAC name is N-[2-[(2E)-2-[1-[4-[4-[(1S)-cyclohex-3-en-1-yl]cyclohexyl]cyclohex-3-en-1-yl]ethylidene]cyclohex-3-en-1-yl]-3-ethylpentyl]-1,2,4a,5,6,8a-hexahydronaphthalen-2-amine.
| Compound Name | N-[2-[(2E)-2-[1-[4-[4-[(1S)-cyclohex-3-en-1-yl]cyclohexyl]cyclohex-3-en-1-yl]ethylidene]cyclohex-3-en-1-yl]-3-ethylpentyl]-1,2,4a,5,6,8a-hexahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 67951448 |
| Molecular Formula | C43H65N |
| Molecular Weight | 596.00 g/mol |
| Exact Mass | 595.51 |
| IUPAC Name | N-[2-[(2E)-2-[1-[4-[4-[(1S)-cyclohex-3-en-1-yl]cyclohexyl]cyclohex-3-en-1-yl]ethylidene]cyclohex-3-en-1-yl]-3-ethylpentyl]-1,2,4a,5,6,8a-hexahydronaphthalen-2-amine |
| SMILES | CCC(CC)C(CNC1C=CC2CCC=CC2C1)C1CCC=C/C1=C(/C)C1CC=C(C2CCC([C@@H]3CC=CCC3)CC2)CC1 |
| InChI | InChI=1S/C43H65N/c1-4-32(5-2)43(30-44-40-28-27-35-15-9-10-16-39(35)29-40)42-18-12-11-17-41(42)31(3)33-19-21-37(22-20-33)38-25-23-36(24-26-38)34-13-7-6-8-14-34/h6-7,10-11,16-17,21,27-28,32-36,38-40,42-44H,4-5,8-9,12-15,18-20,22-26,29-30H2,1-3H3/b41-31+/t33?,34-,35?,36?,38?,39?,40?,42?,43?/m1/s1 |
| InChIKey | DMRUCCCCBNEXGX-KIILIPRRSA-N |
| XLogP | 11.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.00 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|