C31H41N — CID 67951483
N-[3-(1,2,4a,5,6,9,10,10a-octahydrophenanthren-9-yl)hex-5-en-2-yl]-N-methyl-1,7,8,8a-tetrahydronaphthalen-1-amine (PubChem CID 67951483) has the molecular formula C31H41N and a molecular weight of 427.68 g/mol. Its IUPAC name is N-[3-(1,2,4a,5,6,9,10,10a-octahydrophenanthren-9-yl)hex-5-en-2-yl]-N-methyl-1,7,8,8a-tetrahydronaphthalen-1-amine.
| Compound Name | N-[3-(1,2,4a,5,6,9,10,10a-octahydrophenanthren-9-yl)hex-5-en-2-yl]-N-methyl-1,7,8,8a-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 67951483 |
| Molecular Formula | C31H41N |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | N-[3-(1,2,4a,5,6,9,10,10a-octahydrophenanthren-9-yl)hex-5-en-2-yl]-N-methyl-1,7,8,8a-tetrahydronaphthalen-1-amine |
| SMILES | C=CCC(C1CC2CCC=CC2C2=C1C=CCC2)C(C)N(C)C1C=CC=C2C=CCCC21 |
| InChI | InChI=1S/C31H41N/c1-4-12-25(22(2)32(3)31-20-11-15-23-13-5-8-17-27(23)31)30-21-24-14-6-7-16-26(24)28-18-9-10-19-29(28)30/h4-5,7,10-11,13,15-16,19-20,22,24-27,30-31H,1,6,8-9,12,14,17-18,21H2,2-3H3 |
| InChIKey | PYLNSQPVLABUAU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|