C33H44N2 — CID 67951515
(2Z)-2-[3-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a-tetrahydronaphthalen-1-yl)butylidene]-N-phenylheptane-1,7-diamine (PubChem CID 67951515) has the molecular formula C33H44N2 and a molecular weight of 468.73 g/mol. Its IUPAC name is (2Z)-2-[3-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a-tetrahydronaphthalen-1-yl)butylidene]-N-phenylheptane-1,7-diamine.
| Compound Name | (2Z)-2-[3-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a-tetrahydronaphthalen-1-yl)butylidene]-N-phenylheptane-1,7-diamine |
|---|---|
| PubChem CID | 67951515 |
| Molecular Formula | C33H44N2 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | (2Z)-2-[3-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a-tetrahydronaphthalen-1-yl)butylidene]-N-phenylheptane-1,7-diamine |
| SMILES | CC(C/C=C(/CCCCCN)CNc1ccccc1)C1=C2C=CC=CC2C(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C33H44N2/c1-26(20-21-27(13-5-4-12-24-34)25-35-29-16-8-3-9-17-29)30-22-23-31(28-14-6-2-7-15-28)33-19-11-10-18-32(30)33/h3,6,8-11,14-19,21,26,31,33,35H,2,4-5,7,12-13,20,22-25,34H2,1H3/b27-21- |
| InChIKey | FBMAQLLPSVJIEK-MEFGMAGPSA-N |
| XLogP | 8.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|