C38H58N2 — CID 67951528
(Z,6Z)-6-[3-[4-(cyclohexen-1-yl)-2,3,4,4a-tetrahydronaphthalen-1-yl]butylidene]-N'-cyclohexyl-2-pent-4-enylhept-1-ene-1,7-diamine (PubChem CID 67951528) has the molecular formula C38H58N2 and a molecular weight of 542.90 g/mol. Its IUPAC name is (Z,6Z)-6-[3-[4-(cyclohexen-1-yl)-2,3,4,4a-tetrahydronaphthalen-1-yl]butylidene]-N'-cyclohexyl-2-pent-4-enylhept-1-ene-1,7-diamine.
| Compound Name | (Z,6Z)-6-[3-[4-(cyclohexen-1-yl)-2,3,4,4a-tetrahydronaphthalen-1-yl]butylidene]-N'-cyclohexyl-2-pent-4-enylhept-1-ene-1,7-diamine |
|---|---|
| PubChem CID | 67951528 |
| Molecular Formula | C38H58N2 |
| Molecular Weight | 542.90 g/mol |
| Exact Mass | 542.46 |
| IUPAC Name | (Z,6Z)-6-[3-[4-(cyclohexen-1-yl)-2,3,4,4a-tetrahydronaphthalen-1-yl]butylidene]-N'-cyclohexyl-2-pent-4-enylhept-1-ene-1,7-diamine |
| SMILES | C=CCCC/C(=C/N)CCC/C(=C/CC(C)C1=C2C=CC=CC2C(C2=CCCCC2)CC1)CNC1CCCCC1 |
| InChI | InChI=1S/C38H58N2/c1-3-4-7-15-31(28-39)16-14-17-32(29-40-34-20-10-6-11-21-34)25-24-30(2)35-26-27-36(33-18-8-5-9-19-33)38-23-13-12-22-37(35)38/h3,12-13,18,22-23,25,28,30,34,36,38,40H,1,4-11,14-17,19-21,24,26-27,29,39H2,2H3/b31-28-,32-25- |
| InChIKey | NXKUCIWTTZUYBK-KFDPOIOWSA-N |
| XLogP | 10.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.90 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|