C10H15N — CID 67951567
2,3,5,6,7,8-hexahydronaphthalen-1-amine (PubChem CID 67951567) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydronaphthalen-1-amine.
| Compound Name | 2,3,5,6,7,8-hexahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 67951567 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2,3,5,6,7,8-hexahydronaphthalen-1-amine |
| SMILES | NC1=C2CCCCC2=CCC1 |
| InChI | InChI=1S/C10H15N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h5H,1-4,6-7,11H2 |
| InChIKey | DJPNZJIEIPFAKT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |