C10H17N — CID 67951578
1,2,3,5,6,7,8,8a-octahydronaphthalen-1-amine (PubChem CID 67951578) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 1,2,3,5,6,7,8,8a-octahydronaphthalen-1-amine.
| Compound Name | 1,2,3,5,6,7,8,8a-octahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 67951578 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1,2,3,5,6,7,8,8a-octahydronaphthalen-1-amine |
| SMILES | NC1CCC=C2CCCCC21 |
| InChI | InChI=1S/C10H17N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h5,9-10H,1-4,6-7,11H2 |
| InChIKey | QTHZCUICQOOODR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|