C34H46N2 — CID 67951594
2-(3,4-dihydro-2H-pyrrol-3-yl)-4-[4-[4-(1,2,5,6,7,8-hexahydronaphthalen-2-yl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]cyclohexyl]-2,5-dihydro-1H-pyrrole (PubChem CID 67951594) has the molecular formula C34H46N2 and a molecular weight of 482.76 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyrrol-3-yl)-4-[4-[4-(1,2,5,6,7,8-hexahydronaphthalen-2-yl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]cyclohexyl]-2,5-dihydro-1H-pyrrole.
| Compound Name | 2-(3,4-dihydro-2H-pyrrol-3-yl)-4-[4-[4-(1,2,5,6,7,8-hexahydronaphthalen-2-yl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]cyclohexyl]-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 67951594 |
| Molecular Formula | C34H46N2 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 482.37 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyrrol-3-yl)-4-[4-[4-(1,2,5,6,7,8-hexahydronaphthalen-2-yl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl]cyclohexyl]-2,5-dihydro-1H-pyrrole |
| SMILES | C1=CC2=C(C3C=CC4=C(CCCC4)C3)CCC(C3CCC(C4=CC(C5CC=NC5)NC4)CC3)C2CC1 |
| InChI | InChI=1S/C34H46N2/c1-2-6-26-19-27(14-11-23(26)5-1)31-16-15-30(32-7-3-4-8-33(31)32)25-12-9-24(10-13-25)29-20-34(36-22-29)28-17-18-35-21-28/h4,8,11,14,18,20,24-25,27-28,30,32,34,36H,1-3,5-7,9-10,12-13,15-17,19,21-22H2 |
| InChIKey | IBDHBYVSDYLNID-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|