C46H73N3 — CID 67951615
7-[3-[4-(1,2,4a,4b,5,6,7,8,8a,9-decahydrophenanthren-9-yl)-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]butyl]-6-(aminomethyl)-8-N-cyclohexa-1,3-dien-1-yl-2-ethylnonane-1,8-diamine (PubChem CID 67951615) has the molecular formula C46H73N3 and a molecular weight of 668.11 g/mol. Its IUPAC name is 7-[3-[4-(1,2,4a,4b,5,6,7,8,8a,9-decahydrophenanthren-9-yl)-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]butyl]-6-(aminomethyl)-8-N-cyclohexa-1,3-dien-1-yl-2-ethylnonane-1,8-diamine.
| Compound Name | 7-[3-[4-(1,2,4a,4b,5,6,7,8,8a,9-decahydrophenanthren-9-yl)-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]butyl]-6-(aminomethyl)-8-N-cyclohexa-1,3-dien-1-yl-2-ethylnonane-1,8-diamine |
|---|---|
| PubChem CID | 67951615 |
| Molecular Formula | C46H73N3 |
| Molecular Weight | 668.11 g/mol |
| Exact Mass | 667.58 |
| IUPAC Name | 7-[3-[4-(1,2,4a,4b,5,6,7,8,8a,9-decahydrophenanthren-9-yl)-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]butyl]-6-(aminomethyl)-8-N-cyclohexa-1,3-dien-1-yl-2-ethylnonane-1,8-diamine |
| SMILES | CCC(CN)CCCC(CN)C(CCC(C)C1C=CC(C2C=C3CCC=CC3C3CCCCC23)C2C=CCCC12)C(C)NC1=CC=CCC1 |
| InChI | InChI=1S/C46H73N3/c1-4-34(30-47)15-14-17-36(31-48)39(33(3)49-37-18-6-5-7-19-37)26-25-32(2)38-27-28-45(43-23-12-10-21-41(38)43)46-29-35-16-8-9-20-40(35)42-22-11-13-24-44(42)46/h5-6,9,12,18,20,23,27-29,32-34,36,38-46,49H,4,7-8,10-11,13-17,19,21-22,24-26,30-31,47-48H2,1-3H3 |
| InChIKey | GMSFOTILDPAPME-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.11 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|