C49H71N — CID 67951620
(8E)-4-(4,4a,5,6-tetrahydronaphthalen-1-yl)-6-(3-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-9,10-dimethyl-2-[3-[(Z)-pent-3-enyl]cyclohexyl]-4-azabicyclo[9.4.0]pentadec-8-ene (PubChem CID 67951620) has the molecular formula C49H71N and a molecular weight of 674.11 g/mol. Its IUPAC name is (8E)-4-(4,4a,5,6-tetrahydronaphthalen-1-yl)-6-(3-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-9,10-dimethyl-2-[3-[(Z)-pent-3-enyl]cyclohexyl]-4-azabicyclo[9.4.0]pentadec-8-ene.
| Compound Name | (8E)-4-(4,4a,5,6-tetrahydronaphthalen-1-yl)-6-(3-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-9,10-dimethyl-2-[3-[(Z)-pent-3-enyl]cyclohexyl]-4-azabicyclo[9.4.0]pentadec-8-ene |
|---|---|
| PubChem CID | 67951620 |
| Molecular Formula | C49H71N |
| Molecular Weight | 674.11 g/mol |
| Exact Mass | 673.56 |
| IUPAC Name | (8E)-4-(4,4a,5,6-tetrahydronaphthalen-1-yl)-6-(3-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-9,10-dimethyl-2-[3-[(Z)-pent-3-enyl]cyclohexyl]-4-azabicyclo[9.4.0]pentadec-8-ene |
| SMILES | C/C=C\CCC1CCCC(C2CN(C3=C4C=CCCC4CC=C3)CC(C3C=C(C4=CC=CCC4)CCC3)C/C=C(\C)C(C)C3CCCCC23)C1 |
| InChI | InChI=1S/C49H71N/c1-4-5-7-17-38-18-14-25-43(32-38)48-35-50(49-29-16-22-40-21-10-11-27-46(40)49)34-44(31-30-36(2)37(3)45-26-12-13-28-47(45)48)42-24-15-23-41(33-42)39-19-8-6-9-20-39/h4-6,8,11,16,19,27,29-30,33,37-38,40,42-45,47-48H,7,9-10,12-15,17-18,20-26,28,31-32,34-35H2,1-3H3/b5-4-,36-30+ |
| InChIKey | JHLBBNVIRMPWJI-DRGHHUFXSA-N |
| XLogP | 13.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.11 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|