C44H43B2NO4 — CID 67951631
7-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]benzo[c]carbazole (PubChem CID 67951631) has the molecular formula C44H43B2NO4 and a molecular weight of 671.46 g/mol. Its IUPAC name is 7-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]benzo[c]carbazole.
| Compound Name | 7-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]benzo[c]carbazole |
|---|---|
| PubChem CID | 67951631 |
| Molecular Formula | C44H43B2NO4 |
| Molecular Weight | 671.46 g/mol |
| Exact Mass | 671.34 |
| IUPAC Name | 7-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]benzo[c]carbazole |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4c5c6ccccc6c(B6OC(C)(C)C(C)(C)O6)cc5n(-c5ccccc5)c4c3)c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C44H43B2NO4/c1-41(2)42(3,4)49-45(48-41)36-25-24-30(31-18-12-13-19-32(31)36)28-22-23-35-38(26-28)47(29-16-10-9-11-17-29)39-27-37(33-20-14-15-21-34(33)40(35)39)46-50-43(5,6)44(7,8)51-46/h9-27H,1-8H3 |
| InChIKey | NSLVYKAOZHQLRF-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.46 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|