C32H39N — CID 67951663
3-[5-[4-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a,5,6-hexahydronaphthalen-1-yl)cyclohexen-1-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydro-2H-pyrrole (PubChem CID 67951663) has the molecular formula C32H39N and a molecular weight of 437.67 g/mol. Its IUPAC name is 3-[5-[4-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a,5,6-hexahydronaphthalen-1-yl)cyclohexen-1-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 3-[5-[4-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a,5,6-hexahydronaphthalen-1-yl)cyclohexen-1-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 67951663 |
| Molecular Formula | C32H39N |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | 3-[5-[4-(4-cyclohexa-1,5-dien-1-yl-2,3,4,4a,5,6-hexahydronaphthalen-1-yl)cyclohexen-1-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydro-2H-pyrrole |
| SMILES | C1=CC(C2=CCC(C3=C4C=CCCC4C(C4=CCCC=C4)CC3)CC2)CC(C2CC=NC2)=C1 |
| InChI | InChI=1S/C32H39N/c1-2-7-24(8-3-1)29-17-18-30(32-12-5-4-11-31(29)32)25-15-13-23(14-16-25)26-9-6-10-27(21-26)28-19-20-33-22-28/h2,5-10,12-13,20,25-26,28-29,31H,1,3-4,11,14-19,21-22H2 |
| InChIKey | SFIRNDPMSGEGST-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|