C36H47N — CID 67951724
3-[(1R)-3-[4-[4-(1,2,4a,7,8,8a-hexahydronaphthalen-2-yl)-3-ethenyl-2-propylcyclohex-3-en-1-yl]cyclohexen-1-yl]cyclohexa-2,4-dien-1-yl]-2,3-dihydroazete (PubChem CID 67951724) has the molecular formula C36H47N and a molecular weight of 493.78 g/mol. Its IUPAC name is 3-[(1R)-3-[4-[4-(1,2,4a,7,8,8a-hexahydronaphthalen-2-yl)-3-ethenyl-2-propylcyclohex-3-en-1-yl]cyclohexen-1-yl]cyclohexa-2,4-dien-1-yl]-2,3-dihydroazete.
| Compound Name | 3-[(1R)-3-[4-[4-(1,2,4a,7,8,8a-hexahydronaphthalen-2-yl)-3-ethenyl-2-propylcyclohex-3-en-1-yl]cyclohexen-1-yl]cyclohexa-2,4-dien-1-yl]-2,3-dihydroazete |
|---|---|
| PubChem CID | 67951724 |
| Molecular Formula | C36H47N |
| Molecular Weight | 493.78 g/mol |
| Exact Mass | 493.37 |
| IUPAC Name | 3-[(1R)-3-[4-[4-(1,2,4a,7,8,8a-hexahydronaphthalen-2-yl)-3-ethenyl-2-propylcyclohex-3-en-1-yl]cyclohexen-1-yl]cyclohexa-2,4-dien-1-yl]-2,3-dihydroazete |
| SMILES | C=CC1=C(C2C=CC3C=CCCC3C2)CCC(C2CC=C(C3=C[C@H](C4C=NC4)CC=C3)CC2)C1CCC |
| InChI | InChI=1S/C36H47N/c1-3-8-36-33(4-2)35(31-18-15-25-9-5-6-10-28(25)22-31)20-19-34(36)27-16-13-26(14-17-27)29-11-7-12-30(21-29)32-23-37-24-32/h4-5,7,9,11,13,15,18,21,23,25,27-28,30-32,34,36H,2-3,6,8,10,12,14,16-17,19-20,22,24H2,1H3/t25?,27?,28?,30-,31?,32?,34?,36?/m1/s1 |
| InChIKey | ORRQXMBOWMFKCU-IZZFXWCTSA-N |
| XLogP | 9.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.78 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|