C25H42O6S — CID 67951823
(1R)-1-[(3S,5R,6R)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]ethane-1,2-diol (PubChem CID 67951823) has the molecular formula C25H42O6S and a molecular weight of 470.67 g/mol. Its IUPAC name is (1R)-1-[(3S,5R,6R)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3S,5R,6R)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 67951823 |
| Molecular Formula | C25H42O6S |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | (1R)-1-[(3S,5R,6R)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]ethane-1,2-diol |
| SMILES | CCCCOC1[C@H](OCCCC)C([C@H](O)CO)O[C@H](Sc2ccccc2)[C@@H]1OCCCC |
| InChI | InChI=1S/C25H42O6S/c1-4-7-15-28-22-21(20(27)18-26)31-25(32-19-13-11-10-12-14-19)24(30-17-9-6-3)23(22)29-16-8-5-2/h10-14,20-27H,4-9,15-18H2,1-3H3/t20-,21?,22-,23?,24-,25-/m1/s1 |
| InChIKey | QGUXLNNLQGNING-LLNFIGDGSA-N |
| XLogP | 4.41 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|