C29H50O6S — CID 67951824
(2R)-2-butoxy-2-[(3S,5R,6R)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]ethanol (PubChem CID 67951824) has the molecular formula C29H50O6S and a molecular weight of 526.78 g/mol. Its IUPAC name is (2R)-2-butoxy-2-[(3S,5R,6R)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]ethanol.
| Compound Name | (2R)-2-butoxy-2-[(3S,5R,6R)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]ethanol |
|---|---|
| PubChem CID | 67951824 |
| Molecular Formula | C29H50O6S |
| Molecular Weight | 526.78 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | (2R)-2-butoxy-2-[(3S,5R,6R)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]ethanol |
| SMILES | CCCCOC1[C@H](OCCCC)C([C@@H](CO)OCCCC)O[C@H](Sc2ccccc2)[C@@H]1OCCCC |
| InChI | InChI=1S/C29H50O6S/c1-5-9-18-31-24(22-30)25-26(32-19-10-6-2)27(33-20-11-7-3)28(34-21-12-8-4)29(35-25)36-23-16-14-13-15-17-23/h13-17,24-30H,5-12,18-22H2,1-4H3/t24-,25?,26-,27?,28-,29-/m1/s1 |
| InChIKey | POPSTWWUEWFLIL-GNIZAHDBSA-N |
| XLogP | 6.24 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.78 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|