C26H39NO4S — CID 67951856
7-[(1S,3R)-5-cyano-3-hydroxy-2-[4-hydroxy-4-[1-(thiophen-2-ylmethyl)cyclobutyl]butyl]cyclopentyl]heptanoic acid (PubChem CID 67951856) has the molecular formula C26H39NO4S and a molecular weight of 461.67 g/mol. Its IUPAC name is 7-[(1S,3R)-5-cyano-3-hydroxy-2-[4-hydroxy-4-[1-(thiophen-2-ylmethyl)cyclobutyl]butyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,3R)-5-cyano-3-hydroxy-2-[4-hydroxy-4-[1-(thiophen-2-ylmethyl)cyclobutyl]butyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 67951856 |
| Molecular Formula | C26H39NO4S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 7-[(1S,3R)-5-cyano-3-hydroxy-2-[4-hydroxy-4-[1-(thiophen-2-ylmethyl)cyclobutyl]butyl]cyclopentyl]heptanoic acid |
| SMILES | N#CC1C[C@@H](O)C(CCCC(O)C2(Cc3cccs3)CCC2)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C26H39NO4S/c27-18-19-16-23(28)22(21(19)9-3-1-2-4-12-25(30)31)10-5-11-24(29)26(13-7-14-26)17-20-8-6-15-32-20/h6,8,15,19,21-24,28-29H,1-5,7,9-14,16-17H2,(H,30,31)/t19?,21-,22?,23+,24?/m0/s1 |
| InChIKey | WRPYXXNFBOWUSW-FYVAMVFOSA-N |
| XLogP | 5.55 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|