About 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride
6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride (PubChem CID 67953996) has the molecular formula C8H9Cl2N3
and a molecular weight of 218.09 g/mol. Its IUPAC name is 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride |
| PubChem CID | 67953996 |
| Molecular Formula | C8H9Cl2N3 |
| Molecular Weight | 218.09 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride |
| SMILES | Cc1c(N)nc2ccc(Cl)cn12.Cl |
| InChI | InChI=1S/C8H8ClN3.ClH/c1-5-8(10)11-7-3-2-6(9)4-12(5)7;/h2-4H,10H2,1H3;1H |
| InChIKey | DZTRFCGESHWRLS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride?
The IUPAC name of 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride (CID 67953996) is 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride.
What is the SMILES notation for 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride?
The canonical SMILES for 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride is Cc1c(N)nc2ccc(Cl)cn12.Cl.
What is the InChIKey of 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride?
The InChIKey is DZTRFCGESHWRLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3.ClH/c1-5-8(10)11-7-3-2-6(9)4-12(5)7;/h2-4H,10H2,1H3;1H.
What are the key properties of 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride?
6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride has a molecular weight of 218.09 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-methylimidazo[1,2-a]pyridin-2-amine;hydrochloride is sourced from PubChem (CID 67953996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).