C17H18O2 — CID 67954177
ethanol;tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol (PubChem CID 67954177) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is ethanol;tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol.
| Compound Name | ethanol;tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol |
|---|---|
| PubChem CID | 67954177 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethanol;tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol |
| SMILES | CCO.OC1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C15H12O.C2H6O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15;1-2-3/h1-10,15-16H;3H,2H2,1H3 |
| InChIKey | DEISHXZBNDTGHW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|