About 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one
2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 67954471) has the molecular formula C22H22IN3O
and a molecular weight of 471.34 g/mol. Its IUPAC name is 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one |
| PubChem CID | 67954471 |
| Molecular Formula | C22H22IN3O |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | CC(C)CCN1C(=O)C2(CC2c2ccc3c(I)[nH]nc3c2)c2ccccc21 |
| InChI | InChI=1S/C22H22IN3O/c1-13(2)9-10-26-19-6-4-3-5-16(19)22(21(26)27)12-17(22)14-7-8-15-18(11-14)24-25-20(15)23/h3-8,11,13,17H,9-10,12H2,1-2H3,(H,24,25) |
| InChIKey | ZZDWKVXTZPAIHG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one?
The IUPAC name of 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one (CID 67954471) is 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one.
What is the SMILES notation for 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one?
The canonical SMILES for 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one is CC(C)CCN1C(=O)C2(CC2c2ccc3c(I)[nH]nc3c2)c2ccccc21.
What is the InChIKey of 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one?
The InChIKey is ZZDWKVXTZPAIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22IN3O/c1-13(2)9-10-26-19-6-4-3-5-16(19)22(21(26)27)12-17(22)14-7-8-15-18(11-14)24-25-20(15)23/h3-8,11,13,17H,9-10,12H2,1-2H3,(H,24,25).
What are the key properties of 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one?
2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one has a molecular weight of 471.34 g/mol, XLogP of 4.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-iodo-2H-indazol-6-yl)-1'-(3-methylbutyl)spiro[cyclopropane-1,3'-indole]-2'-one is sourced from PubChem (CID 67954471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).