About 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid
4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid (PubChem CID 67954661) has the molecular formula C13H16F3N3O5
and a molecular weight of 351.28 g/mol. Its IUPAC name is 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
| PubChem CID | 67954661 |
| Molecular Formula | C13H16F3N3O5 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(Oc2cc(C(O)CO)nc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C13H16F3N3O5/c14-13(15,16)11-17-8(9(21)6-20)5-10(18-11)24-7-1-3-19(4-2-7)12(22)23/h5,7,9,20-21H,1-4,6H2,(H,22,23) |
| InChIKey | UBBCLCVONSEWCF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid?
The IUPAC name of 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid (CID 67954661) is 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid.
What is the SMILES notation for 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid?
The canonical SMILES for 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid is O=C(O)N1CCC(Oc2cc(C(O)CO)nc(C(F)(F)F)n2)CC1.
What is the InChIKey of 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid?
The InChIKey is UBBCLCVONSEWCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N3O5/c14-13(15,16)11-17-8(9(21)6-20)5-10(18-11)24-7-1-3-19(4-2-7)12(22)23/h5,7,9,20-21H,1-4,6H2,(H,22,23).
What are the key properties of 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid?
4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid has a molecular weight of 351.28 g/mol, XLogP of 1.04, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(1,2-dihydroxyethyl)-2-(trifluoromethyl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid is sourced from PubChem (CID 67954661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).