C27H38FNO3Si — CID 67955911
tert-butyl-[(1S,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl]carbamic acid (PubChem CID 67955911) has the molecular formula C27H38FNO3Si and a molecular weight of 471.69 g/mol. Its IUPAC name is tert-butyl-[(1S,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl]carbamic acid.
| Compound Name | tert-butyl-[(1S,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 67955911 |
| Molecular Formula | C27H38FNO3Si |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | tert-butyl-[(1S,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1CC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C27H38FNO3Si/c1-26(2,3)29(25(30)31)24-18-17-20(19-23(24)28)32-33(27(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24H,17-19H2,1-6H3,(H,30,31)/t20-,23+,24+/m1/s1 |
| InChIKey | IMYNKICYISIGIC-QDSKXPNFSA-N |
| XLogP | 5.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|