C23H30FNO3Si — CID 67956363
[(1S,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl]carbamic acid (PubChem CID 67956363) has the molecular formula C23H30FNO3Si and a molecular weight of 415.58 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl]carbamic acid.
| Compound Name | [(1S,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 67956363 |
| Molecular Formula | C23H30FNO3Si |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [(1S,2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl]carbamic acid |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC[C@H](NC(=O)O)[C@@H](F)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30FNO3Si/c1-23(2,3)29(18-10-6-4-7-11-18,19-12-8-5-9-13-19)28-17-14-15-21(20(24)16-17)25-22(26)27/h4-13,17,20-21,25H,14-16H2,1-3H3,(H,26,27)/t17-,20+,21+/m1/s1 |
| InChIKey | MULFBBQJDZEMJZ-QMMLZNLJSA-N |
| XLogP | 4.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|