About 2,6-dimethyl-1,3-dioxocane
2,6-dimethyl-1,3-dioxocane (PubChem CID 67957151) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2,6-dimethyl-1,3-dioxocane.
Molecular Properties
| Compound Name | 2,6-dimethyl-1,3-dioxocane |
| PubChem CID | 67957151 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2,6-dimethyl-1,3-dioxocane |
| SMILES | CC1CCOC(C)OCC1 |
| InChI | InChI=1S/C8H16O2/c1-7-3-5-9-8(2)10-6-4-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | FEMXTXVIURLSQY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-1,3-dioxocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-1,3-dioxocane?
The IUPAC name of 2,6-dimethyl-1,3-dioxocane (CID 67957151) is 2,6-dimethyl-1,3-dioxocane.
What is the SMILES notation for 2,6-dimethyl-1,3-dioxocane?
The canonical SMILES for 2,6-dimethyl-1,3-dioxocane is CC1CCOC(C)OCC1.
What is the InChIKey of 2,6-dimethyl-1,3-dioxocane?
The InChIKey is FEMXTXVIURLSQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-7-3-5-9-8(2)10-6-4-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 2,6-dimethyl-1,3-dioxocane?
2,6-dimethyl-1,3-dioxocane has a molecular weight of 144.21 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-1,3-dioxocane is sourced from PubChem (CID 67957151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).