About 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine
7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine (PubChem CID 67957870) has the molecular formula C12H11NO2
and a molecular weight of 201.23 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine.
Molecular Properties
| Compound Name | 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine |
| PubChem CID | 67957870 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine |
| SMILES | COc1ccc2c3c(oc2c1)C=NCC3 |
| InChI | InChI=1S/C12H11NO2/c1-14-8-2-3-9-10-4-5-13-7-12(10)15-11(9)6-8/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | QBRYVZKBQDQVHF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine?
The IUPAC name of 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine (CID 67957870) is 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine.
What is the SMILES notation for 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine?
The canonical SMILES for 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine is COc1ccc2c3c(oc2c1)C=NCC3.
What is the InChIKey of 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine?
The InChIKey is QBRYVZKBQDQVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c1-14-8-2-3-9-10-4-5-13-7-12(10)15-11(9)6-8/h2-3,6-7H,4-5H2,1H3.
What are the key properties of 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine?
7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine has a molecular weight of 201.23 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3,4-dihydro-[1]benzofuro[2,3-c]pyridine is sourced from PubChem (CID 67957870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).