About 4-phenylmethoxy-1,2-benzothiazepin-3-one
4-phenylmethoxy-1,2-benzothiazepin-3-one (PubChem CID 67957885) has the molecular formula C16H13NO2S
and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-phenylmethoxy-1,2-benzothiazepin-3-one.
Molecular Properties
| Compound Name | 4-phenylmethoxy-1,2-benzothiazepin-3-one |
| PubChem CID | 67957885 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-phenylmethoxy-1,2-benzothiazepin-3-one |
| SMILES | O=C1NSc2ccccc2C=C1OCc1ccccc1 |
| InChI | InChI=1S/C16H13NO2S/c18-16-14(19-11-12-6-2-1-3-7-12)10-13-8-4-5-9-15(13)20-17-16/h1-10H,11H2,(H,17,18) |
| InChIKey | IPWNNXRJGGHGGH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylmethoxy-1,2-benzothiazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylmethoxy-1,2-benzothiazepin-3-one?
The IUPAC name of 4-phenylmethoxy-1,2-benzothiazepin-3-one (CID 67957885) is 4-phenylmethoxy-1,2-benzothiazepin-3-one.
What is the SMILES notation for 4-phenylmethoxy-1,2-benzothiazepin-3-one?
The canonical SMILES for 4-phenylmethoxy-1,2-benzothiazepin-3-one is O=C1NSc2ccccc2C=C1OCc1ccccc1.
What is the InChIKey of 4-phenylmethoxy-1,2-benzothiazepin-3-one?
The InChIKey is IPWNNXRJGGHGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2S/c18-16-14(19-11-12-6-2-1-3-7-12)10-13-8-4-5-9-15(13)20-17-16/h1-10H,11H2,(H,17,18).
What are the key properties of 4-phenylmethoxy-1,2-benzothiazepin-3-one?
4-phenylmethoxy-1,2-benzothiazepin-3-one has a molecular weight of 283.35 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylmethoxy-1,2-benzothiazepin-3-one is sourced from PubChem (CID 67957885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).