About 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine
4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine (PubChem CID 67958020) has the molecular formula C10H12ClF2N3
and a molecular weight of 247.68 g/mol. Its IUPAC name is 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine |
| PubChem CID | 67958020 |
| Molecular Formula | C10H12ClF2N3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(N2CCC(F)(F)C2)cc1N |
| InChI | InChI=1S/C10H12ClF2N3/c11-6-3-7(14)8(15)4-9(6)16-2-1-10(12,13)5-16/h3-4H,1-2,5,14-15H2 |
| InChIKey | UIBRHYVJIKTBMT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine?
The IUPAC name of 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine (CID 67958020) is 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine.
What is the SMILES notation for 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine?
The canonical SMILES for 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine is Nc1cc(Cl)c(N2CCC(F)(F)C2)cc1N.
What is the InChIKey of 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine?
The InChIKey is UIBRHYVJIKTBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClF2N3/c11-6-3-7(14)8(15)4-9(6)16-2-1-10(12,13)5-16/h3-4H,1-2,5,14-15H2.
What are the key properties of 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine?
4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine has a molecular weight of 247.68 g/mol, XLogP of 2.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(3,3-difluoropyrrolidin-1-yl)benzene-1,2-diamine is sourced from PubChem (CID 67958020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).