About 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one (PubChem CID 67958550) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one.
Molecular Properties
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one |
| PubChem CID | 67958550 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1cc(C)oc(=O)c1 |
| InChI | InChI=1S/C16H22O3/c1-12(2)6-5-7-13(3)8-9-18-15-10-14(4)19-16(17)11-15/h6,8,10-11H,5,7,9H2,1-4H3/b13-8+ |
| InChIKey | JXPKWKQVZZPHBK-MDWZMJQESA-N |
| XLogP | 4.02 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one?
The IUPAC name of 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one (CID 67958550) is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one.
What is the SMILES notation for 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one?
The canonical SMILES for 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one is CC(C)=CCC/C(C)=C/COc1cc(C)oc(=O)c1.
What is the InChIKey of 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one?
The InChIKey is JXPKWKQVZZPHBK-MDWZMJQESA-N. The full InChI is InChI=1S/C16H22O3/c1-12(2)6-5-7-13(3)8-9-18-15-10-14(4)19-16(17)11-15/h6,8,10-11H,5,7,9H2,1-4H3/b13-8+.
What are the key properties of 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one?
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one has a molecular weight of 262.35 g/mol, XLogP of 4.02, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methylpyran-2-one is sourced from PubChem (CID 67958550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).