About 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole
5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole (PubChem CID 67958663) has the molecular formula C32H24N2O4S2
and a molecular weight of 564.69 g/mol. Its IUPAC name is 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole.
Molecular Properties
| Compound Name | 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole |
| PubChem CID | 67958663 |
| Molecular Formula | C32H24N2O4S2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole |
| SMILES | Cc1ccc(S(=O)(=O)n2c3ccccc3c3cc4c(cc32)c2ccccc2n4S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H24N2O4S2/c1-21-11-15-23(16-12-21)39(35,36)33-29-9-5-3-7-25(29)27-20-32-28(19-31(27)33)26-8-4-6-10-30(26)34(32)40(37,38)24-17-13-22(2)14-18-24/h3-20H,1-2H3 |
| InChIKey | CWRLRXJNCYBCSL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole?
The IUPAC name of 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole (CID 67958663) is 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole.
What is the SMILES notation for 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole?
The canonical SMILES for 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole is Cc1ccc(S(=O)(=O)n2c3ccccc3c3cc4c(cc32)c2ccccc2n4S(=O)(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole?
The InChIKey is CWRLRXJNCYBCSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H24N2O4S2/c1-21-11-15-23(16-12-21)39(35,36)33-29-9-5-3-7-25(29)27-20-32-28(19-31(27)33)26-8-4-6-10-30(26)34(32)40(37,38)24-17-13-22(2)14-18-24/h3-20H,1-2H3.
What are the key properties of 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole?
5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole has a molecular weight of 564.69 g/mol, XLogP of 6.99, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,11-bis-(4-methylphenyl)sulfonylindolo[3,2-b]carbazole is sourced from PubChem (CID 67958663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).