About 4-pyridin-4-yloxadiazole
4-pyridin-4-yloxadiazole (PubChem CID 67958919) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is 4-pyridin-4-yloxadiazole.
Molecular Properties
| Compound Name | 4-pyridin-4-yloxadiazole |
| PubChem CID | 67958919 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 4-pyridin-4-yloxadiazole |
| SMILES | c1cc(-c2conn2)ccn1 |
| InChI | InChI=1S/C7H5N3O/c1-3-8-4-2-6(1)7-5-11-10-9-7/h1-5H |
| InChIKey | MAWBFPPVMKRZOO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-pyridin-4-yloxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-yloxadiazole?
The IUPAC name of 4-pyridin-4-yloxadiazole (CID 67958919) is 4-pyridin-4-yloxadiazole.
What is the SMILES notation for 4-pyridin-4-yloxadiazole?
The canonical SMILES for 4-pyridin-4-yloxadiazole is c1cc(-c2conn2)ccn1.
What is the InChIKey of 4-pyridin-4-yloxadiazole?
The InChIKey is MAWBFPPVMKRZOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O/c1-3-8-4-2-6(1)7-5-11-10-9-7/h1-5H.
What are the key properties of 4-pyridin-4-yloxadiazole?
4-pyridin-4-yloxadiazole has a molecular weight of 147.14 g/mol, XLogP of 1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-yloxadiazole is sourced from PubChem (CID 67958919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).