C14H16F3N5O — CID 67959049
5-methyl-N-[2-(pyridin-3-ylamino)ethyl]-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (PubChem CID 67959049) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is 5-methyl-N-[2-(pyridin-3-ylamino)ethyl]-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
| Compound Name | 5-methyl-N-[2-(pyridin-3-ylamino)ethyl]-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 67959049 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-methyl-N-[2-(pyridin-3-ylamino)ethyl]-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCNc2cccnc2)cnn1CC(F)(F)F |
| InChI | InChI=1S/C14H16F3N5O/c1-10-12(8-21-22(10)9-14(15,16)17)13(23)20-6-5-19-11-3-2-4-18-7-11/h2-4,7-8,19H,5-6,9H2,1H3,(H,20,23) |
| InChIKey | SYDOXXVFTCHTQC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|