About (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid
(6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid (PubChem CID 67959147) has the molecular formula C15H15ClN2O5
and a molecular weight of 338.75 g/mol. Its IUPAC name is (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid.
Molecular Properties
| Compound Name | (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid |
| PubChem CID | 67959147 |
| Molecular Formula | C15H15ClN2O5 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1/C=C1\CN(C)C(=O)CN(C(=O)O)C1=O |
| InChI | InChI=1S/C15H15ClN2O5/c1-17-7-10(14(20)18(15(21)22)8-13(17)19)5-9-6-11(16)3-4-12(9)23-2/h3-6H,7-8H2,1-2H3,(H,21,22)/b10-5+ |
| InChIKey | GENWLMFBJYBGCH-BJMVGYQFSA-N |
| XLogP | 1.71 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid?
The IUPAC name of (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid (CID 67959147) is (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid.
What is the SMILES notation for (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid?
The canonical SMILES for (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid is COc1ccc(Cl)cc1/C=C1\CN(C)C(=O)CN(C(=O)O)C1=O.
What is the InChIKey of (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid?
The InChIKey is GENWLMFBJYBGCH-BJMVGYQFSA-N. The full InChI is InChI=1S/C15H15ClN2O5/c1-17-7-10(14(20)18(15(21)22)8-13(17)19)5-9-6-11(16)3-4-12(9)23-2/h3-6H,7-8H2,1-2H3,(H,21,22)/b10-5+.
What are the key properties of (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid?
(6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid has a molecular weight of 338.75 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-[(5-chloro-2-methoxyphenyl)methylidene]-4-methyl-3,7-dioxo-1,4-diazepane-1-carboxylic acid is sourced from PubChem (CID 67959147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).