About 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide
5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (PubChem CID 67959315) has the molecular formula C7H8F3N3O
and a molecular weight of 207.16 g/mol. Its IUPAC name is 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| PubChem CID | 67959315 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(N)=O)cnn1CC(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O/c1-4-5(6(11)14)2-12-13(4)3-7(8,9)10/h2H,3H2,1H3,(H2,11,14) |
| InChIKey | YZVHDIKKARMHKA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The IUPAC name of 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (CID 67959315) is 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
What is the SMILES notation for 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The canonical SMILES for 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide is Cc1c(C(N)=O)cnn1CC(F)(F)F.
What is the InChIKey of 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The InChIKey is YZVHDIKKARMHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O/c1-4-5(6(11)14)2-12-13(4)3-7(8,9)10/h2H,3H2,1H3,(H2,11,14).
What are the key properties of 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide has a molecular weight of 207.16 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide is sourced from PubChem (CID 67959315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).