About 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole
5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole (PubChem CID 67959600) has the molecular formula C22H19F2N5O
and a molecular weight of 407.42 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole.
Molecular Properties
| Compound Name | 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole |
| PubChem CID | 67959600 |
| Molecular Formula | C22H19F2N5O |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole |
| SMILES | Fc1cccc(F)c1-c1ccc2[nH]nc(-c3cncc(OC4CCCNC4)n3)c2c1 |
| InChI | InChI=1S/C22H19F2N5O/c23-16-4-1-5-17(24)21(16)13-6-7-18-15(9-13)22(29-28-18)19-11-26-12-20(27-19)30-14-3-2-8-25-10-14/h1,4-7,9,11-12,14,25H,2-3,8,10H2,(H,28,29) |
| InChIKey | LRZCLGRWOPGGBZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole?
The IUPAC name of 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole (CID 67959600) is 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole.
What is the SMILES notation for 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole?
The canonical SMILES for 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole is Fc1cccc(F)c1-c1ccc2[nH]nc(-c3cncc(OC4CCCNC4)n3)c2c1.
What is the InChIKey of 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole?
The InChIKey is LRZCLGRWOPGGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2N5O/c23-16-4-1-5-17(24)21(16)13-6-7-18-15(9-13)22(29-28-18)19-11-26-12-20(27-19)30-14-3-2-8-25-10-14/h1,4-7,9,11-12,14,25H,2-3,8,10H2,(H,28,29).
What are the key properties of 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole?
5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole has a molecular weight of 407.42 g/mol, XLogP of 4.10, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-difluorophenyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole is sourced from PubChem (CID 67959600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).