C22H21FN6 — CID 67959669
1-[6-[5-(3-fluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-amine (PubChem CID 67959669) has the molecular formula C22H21FN6 and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-[6-[5-(3-fluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-amine.
| Compound Name | 1-[6-[5-(3-fluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 67959669 |
| Molecular Formula | C22H21FN6 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[6-[5-(3-fluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-amine |
| SMILES | NC1CCN(c2cncc(-c3n[nH]c4ccc(-c5cccc(F)c5)cc34)n2)CC1 |
| InChI | InChI=1S/C22H21FN6/c23-16-3-1-2-14(10-16)15-4-5-19-18(11-15)22(28-27-19)20-12-25-13-21(26-20)29-8-6-17(24)7-9-29/h1-5,10-13,17H,6-9,24H2,(H,27,28) |
| InChIKey | WQXYMINUYVLULB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |