About 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol
1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol (PubChem CID 67959841) has the molecular formula C22H19F2N5O
and a molecular weight of 407.42 g/mol. Its IUPAC name is 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol |
| PubChem CID | 67959841 |
| Molecular Formula | C22H19F2N5O |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol |
| SMILES | OC1CCN(c2cncc(-c3n[nH]c4ccc(-c5c(F)cccc5F)cc34)n2)CC1 |
| InChI | InChI=1S/C22H19F2N5O/c23-16-2-1-3-17(24)21(16)13-4-5-18-15(10-13)22(28-27-18)19-11-25-12-20(26-19)29-8-6-14(30)7-9-29/h1-5,10-12,14,30H,6-9H2,(H,27,28) |
| InChIKey | UQJUFHPFHXUISQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol?
The IUPAC name of 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol (CID 67959841) is 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol.
What is the SMILES notation for 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol?
The canonical SMILES for 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol is OC1CCN(c2cncc(-c3n[nH]c4ccc(-c5c(F)cccc5F)cc34)n2)CC1.
What is the InChIKey of 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol?
The InChIKey is UQJUFHPFHXUISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2N5O/c23-16-2-1-3-17(24)21(16)13-4-5-18-15(10-13)22(28-27-18)19-11-25-12-20(26-19)29-8-6-14(30)7-9-29/h1-5,10-12,14,30H,6-9H2,(H,27,28).
What are the key properties of 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol?
1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol has a molecular weight of 407.42 g/mol, XLogP of 3.93, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[5-(2,6-difluorophenyl)-1H-indazol-3-yl]pyrazin-2-yl]piperidin-4-ol is sourced from PubChem (CID 67959841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).