About 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine
6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine (PubChem CID 67959898) has the molecular formula C23H21F2N5
and a molecular weight of 405.45 g/mol. Its IUPAC name is 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine |
| PubChem CID | 67959898 |
| Molecular Formula | C23H21F2N5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine |
| SMILES | Fc1cccc(F)c1-c1ccc2[nH]cc(-c3cncc(NC4CCNCC4)n3)c2c1 |
| InChI | InChI=1S/C23H21F2N5/c24-18-2-1-3-19(25)23(18)14-4-5-20-16(10-14)17(11-28-20)21-12-27-13-22(30-21)29-15-6-8-26-9-7-15/h1-5,10-13,15,26,28H,6-9H2,(H,29,30) |
| InChIKey | HHPQRNFKKTUMOC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine?
The IUPAC name of 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine (CID 67959898) is 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine.
What is the SMILES notation for 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine?
The canonical SMILES for 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine is Fc1cccc(F)c1-c1ccc2[nH]cc(-c3cncc(NC4CCNCC4)n3)c2c1.
What is the InChIKey of 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine?
The InChIKey is HHPQRNFKKTUMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F2N5/c24-18-2-1-3-19(25)23(18)14-4-5-20-16(10-14)17(11-28-20)21-12-27-13-22(30-21)29-15-6-8-26-9-7-15/h1-5,10-13,15,26,28H,6-9H2,(H,29,30).
What are the key properties of 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine?
6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine has a molecular weight of 405.45 g/mol, XLogP of 4.73, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(2,6-difluorophenyl)-1H-indol-3-yl]-N-piperidin-4-ylpyrazin-2-amine is sourced from PubChem (CID 67959898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).