About 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one
2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one (PubChem CID 67960575) has the molecular formula C9H12FN3O2
and a molecular weight of 213.21 g/mol. Its IUPAC name is 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one |
| PubChem CID | 67960575 |
| Molecular Formula | C9H12FN3O2 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(OC2CCNC[C@@H]2F)[nH]1 |
| InChI | InChI=1S/C9H12FN3O2/c10-6-5-11-3-1-7(6)15-9-12-4-2-8(14)13-9/h2,4,6-7,11H,1,3,5H2,(H,12,13,14)/t6-,7?/m0/s1 |
| InChIKey | JLCOPKZAGAVTGX-PKPIPKONSA-N |
| XLogP | -0.15 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one?
The IUPAC name of 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one (CID 67960575) is 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one?
The canonical SMILES for 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one is O=c1ccnc(OC2CCNC[C@@H]2F)[nH]1.
What is the InChIKey of 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one?
The InChIKey is JLCOPKZAGAVTGX-PKPIPKONSA-N. The full InChI is InChI=1S/C9H12FN3O2/c10-6-5-11-3-1-7(6)15-9-12-4-2-8(14)13-9/h2,4,6-7,11H,1,3,5H2,(H,12,13,14)/t6-,7?/m0/s1.
What are the key properties of 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one?
2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one has a molecular weight of 213.21 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-3-fluoropiperidin-4-yl]oxy-1H-pyrimidin-6-one is sourced from PubChem (CID 67960575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).