C30H37N7O3 — CID 67960712
2-[(3S,4S)-3-methyl-4-[(2-phenylacetyl)amino]-5-(2H-triazol-4-ylmethylamino)pentyl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 67960712) has the molecular formula C30H37N7O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-[(3S,4S)-3-methyl-4-[(2-phenylacetyl)amino]-5-(2H-triazol-4-ylmethylamino)pentyl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | 2-[(3S,4S)-3-methyl-4-[(2-phenylacetyl)amino]-5-(2H-triazol-4-ylmethylamino)pentyl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 67960712 |
| Molecular Formula | C30H37N7O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | 2-[(3S,4S)-3-methyl-4-[(2-phenylacetyl)amino]-5-(2H-triazol-4-ylmethylamino)pentyl]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | C[C@@H](CCC1(C(N)=O)Cc2cccc3c2N1C(=O)CCC3)[C@@H](CNCc1cn[nH]n1)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C30H37N7O3/c1-20(25(19-32-17-24-18-33-36-35-24)34-26(38)15-21-7-3-2-4-8-21)13-14-30(29(31)40)16-23-11-5-9-22-10-6-12-27(39)37(30)28(22)23/h2-5,7-9,11,18,20,25,32H,6,10,12-17,19H2,1H3,(H2,31,40)(H,34,38)(H,33,35,36)/t20-,25+,30?/m0/s1 |
| InChIKey | SOVZPLCXDVGJBQ-QOYMKSMASA-N |
| XLogP | 2.19 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |