C19H15F3N4O — CID 67961445
N-(diaminomethylidene)-2,8-dimethyl-4-(2,4,6-trifluorophenyl)quinoline-6-carboxamide (PubChem CID 67961445) has the molecular formula C19H15F3N4O and a molecular weight of 372.35 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,8-dimethyl-4-(2,4,6-trifluorophenyl)quinoline-6-carboxamide.
| Compound Name | N-(diaminomethylidene)-2,8-dimethyl-4-(2,4,6-trifluorophenyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 67961445 |
| Molecular Formula | C19H15F3N4O |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-(diaminomethylidene)-2,8-dimethyl-4-(2,4,6-trifluorophenyl)quinoline-6-carboxamide |
| SMILES | Cc1cc(-c2c(F)cc(F)cc2F)c2cc(C(=O)N=C(N)N)cc(C)c2n1 |
| InChI | InChI=1S/C19H15F3N4O/c1-8-3-10(18(27)26-19(23)24)5-13-12(4-9(2)25-17(8)13)16-14(21)6-11(20)7-15(16)22/h3-7H,1-2H3,(H4,23,24,26,27) |
| InChIKey | DAWBGCLFCMPXKA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|