About 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one
3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one (PubChem CID 67961657) has the molecular formula C16H36O5Si3
and a molecular weight of 392.72 g/mol. Its IUPAC name is 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one.
Molecular Properties
| Compound Name | 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one |
| PubChem CID | 67961657 |
| Molecular Formula | C16H36O5Si3 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one |
| SMILES | CC1C(=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C16H36O5Si3/c1-12-14(20-23(5,6)7)15(21-24(8,9)10)13(19-16(12)17)11-18-22(2,3)4/h12-15H,11H2,1-10H3 |
| InChIKey | UTNZOLPLBFLCTD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one?
The IUPAC name of 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one (CID 67961657) is 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one.
What is the SMILES notation for 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one?
The canonical SMILES for 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one is CC1C(=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C.
What is the InChIKey of 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one?
The InChIKey is UTNZOLPLBFLCTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36O5Si3/c1-12-14(20-23(5,6)7)15(21-24(8,9)10)13(19-16(12)17)11-18-22(2,3)4/h12-15H,11H2,1-10H3.
What are the key properties of 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one?
3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one has a molecular weight of 392.72 g/mol, XLogP of 3.84, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one is sourced from PubChem (CID 67961657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).