C30H33FNO4P — CID 67962042
3-[[4-[2-(3,4-dimethylphenyl)-1-(3-fluorophenyl)ethyl]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid (PubChem CID 67962042) has the molecular formula C30H33FNO4P and a molecular weight of 521.57 g/mol. Its IUPAC name is 3-[[4-[2-(3,4-dimethylphenyl)-1-(3-fluorophenyl)ethyl]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[2-(3,4-dimethylphenyl)-1-(3-fluorophenyl)ethyl]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 67962042 |
| Molecular Formula | C30H33FNO4P |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 3-[[4-[2-(3,4-dimethylphenyl)-1-(3-fluorophenyl)ethyl]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1ccc(CC(c2cccc(F)c2)c2ccc(CNCCCP(=O)(O)O)cc2-c2ccco2)cc1C |
| InChI | InChI=1S/C30H33FNO4P/c1-21-9-10-23(16-22(21)2)17-28(25-6-3-7-26(31)19-25)27-12-11-24(18-29(27)30-8-4-14-36-30)20-32-13-5-15-37(33,34)35/h3-4,6-12,14,16,18-19,28,32H,5,13,15,17,20H2,1-2H3,(H2,33,34,35) |
| InChIKey | GUHOVUIYRRDXRH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|