C27H33FNO3P — CID 67962049
3-[[4-[2-(3,4-dimethylphenyl)-1-(3-fluorophenyl)ethyl]-3-methylphenyl]methylamino]propylphosphonic acid (PubChem CID 67962049) has the molecular formula C27H33FNO3P and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-[[4-[2-(3,4-dimethylphenyl)-1-(3-fluorophenyl)ethyl]-3-methylphenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[2-(3,4-dimethylphenyl)-1-(3-fluorophenyl)ethyl]-3-methylphenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 67962049 |
| Molecular Formula | C27H33FNO3P |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 3-[[4-[2-(3,4-dimethylphenyl)-1-(3-fluorophenyl)ethyl]-3-methylphenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1ccc(CC(c2cccc(F)c2)c2ccc(CNCCCP(=O)(O)O)cc2C)cc1C |
| InChI | InChI=1S/C27H33FNO3P/c1-19-8-9-22(14-20(19)2)16-27(24-6-4-7-25(28)17-24)26-11-10-23(15-21(26)3)18-29-12-5-13-33(30,31)32/h4,6-11,14-15,17,27,29H,5,12-13,16,18H2,1-3H3,(H2,30,31,32) |
| InChIKey | PEOPIWDAFLZHDW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|