C48H57N3O2S2 — CID 67962210
(Z)-3-[10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-methylprop-2-enenitrile (PubChem CID 67962210) has the molecular formula C48H57N3O2S2 and a molecular weight of 772.14 g/mol. Its IUPAC name is (Z)-3-[10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-methylprop-2-enenitrile.
| Compound Name | (Z)-3-[10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 67962210 |
| Molecular Formula | C48H57N3O2S2 |
| Molecular Weight | 772.14 g/mol |
| Exact Mass | 771.39 |
| IUPAC Name | (Z)-3-[10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-methylprop-2-enenitrile |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3cc4c(s3)c3sc(/C=C(/C)C#N)cc3n4CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C48H57N3O2S2/c1-5-8-11-14-29-50-44-33-43(32-36(4)35-49)54-47(44)48-45(50)34-46(55-48)37-17-19-38(20-18-37)51(39-21-25-41(26-22-39)52-30-15-12-9-6-2)40-23-27-42(28-24-40)53-31-16-13-10-7-3/h17-28,32-34H,5-16,29-31H2,1-4H3/b36-32- |
| InChIKey | GUPHDFBVENGAOD-HIELXXDYSA-N |
| XLogP | 15.48 |
| TPSA | 50.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.14 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|